ChemNet > CAS > 43020-12-8 1-[5-(4-chlorphenyl)-2-methyl-3-furyl]ethan-1-on
43020-12-8 1-[5-(4-chlorphenyl)-2-methyl-3-furyl]ethan-1-on
| Produkt-Name |
1-[5-(4-chlorphenyl)-2-methyl-3-furyl]ethan-1-on |
| Synonyme |
1-[5-(4-chlorphenyl)-2-methylfuran-3-yl]ethanon |
| Englischer Name |
1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one;1-[5-(4-chlorophenyl)-2-methylfuran-3-yl]ethanone |
| Molekulare Formel |
C13H11ClO2 |
| Molecular Weight |
234.6782 |
| InChI |
InChI=1/C13H11ClO2/c1-8(15)12-7-13(16-9(12)2)10-3-5-11(14)6-4-10/h3-7H,1-2H3 |
| CAS Registry Number |
43020-12-8 |
| Molecular Structure |
![43020-12-8 1-[5-(4-chlorphenyl)-2-methyl-3-furyl]ethan-1-on](https://images-a.chemnet.com/suppliers/chembase/cas11/cas43020-12-8.gif)
|
| Dichte |
1.189g/cm3 |
| Schmelzpunkt |
114℃ |
| Siedepunkt |
346.1°C at 760 mmHg |
| Brechungsindex |
1.55 |
| Flammpunkt |
163.1°C |
| Dampfdruck |
5.88E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
